C41H59NO4 — CID 72501734
4-[3a-[(3-carboxypropylamino)methyl]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid (PubChem CID 72501734) has the molecular formula C41H59NO4 and a molecular weight of 629.93 g/mol. Its IUPAC name is 4-[3a-[(3-carboxypropylamino)methyl]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid.
| Compound Name | 4-[3a-[(3-carboxypropylamino)methyl]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 72501734 |
| Molecular Formula | C41H59NO4 |
| Molecular Weight | 629.93 g/mol |
| Exact Mass | 629.44 |
| IUPAC Name | 4-[3a-[(3-carboxypropylamino)methyl]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
| SMILES | C=C(C)C1CCC2(CNCCCC(=O)O)CCC3(C)C(CCC4C5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C41H59NO4/c1-26(2)29-16-21-41(25-42-24-8-9-34(43)44)23-22-39(6)31(35(29)41)14-15-33-38(5)19-17-30(27-10-12-28(13-11-27)36(45)46)37(3,4)32(38)18-20-40(33,39)7/h10-13,17,29,31-33,35,42H,1,8-9,14-16,18-25H2,2-7H3,(H,43,44)(H,45,46) |
| InChIKey | PEJSPZMDDMCGIS-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.93 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|