C44H68N2O2 — CID 123511945
4-[3a-[[2-[ethyl(propyl)amino]ethylamino]methyl]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid (PubChem CID 123511945) has the molecular formula C44H68N2O2 and a molecular weight of 657.04 g/mol. Its IUPAC name is 4-[3a-[[2-[ethyl(propyl)amino]ethylamino]methyl]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid.
| Compound Name | 4-[3a-[[2-[ethyl(propyl)amino]ethylamino]methyl]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 123511945 |
| Molecular Formula | C44H68N2O2 |
| Molecular Weight | 657.04 g/mol |
| Exact Mass | 656.53 |
| IUPAC Name | 4-[3a-[[2-[ethyl(propyl)amino]ethylamino]methyl]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
| SMILES | C=C(C)C1CCC2(CNCCN(CC)CCC)CCC3(C)C(CCC4C5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C44H68N2O2/c1-10-27-46(11-2)28-26-45-29-44-23-18-33(30(3)4)38(44)35-16-17-37-41(7)21-19-34(31-12-14-32(15-13-31)39(47)48)40(5,6)36(41)20-22-43(37,9)42(35,8)24-25-44/h12-15,19,33,35-38,45H,3,10-11,16-18,20-29H2,1-2,4-9H3,(H,47,48) |
| InChIKey | CFSIDFONQGZWEX-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.04 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|