C45H68N2O2 — CID 78127045
4-[5a,5b,8,8,11a-pentamethyl-3a-[(3-piperidin-1-ylpropylamino)methyl]-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid (PubChem CID 78127045) has the molecular formula C45H68N2O2 and a molecular weight of 669.05 g/mol. Its IUPAC name is 4-[5a,5b,8,8,11a-pentamethyl-3a-[(3-piperidin-1-ylpropylamino)methyl]-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid.
| Compound Name | 4-[5a,5b,8,8,11a-pentamethyl-3a-[(3-piperidin-1-ylpropylamino)methyl]-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 78127045 |
| Molecular Formula | C45H68N2O2 |
| Molecular Weight | 669.05 g/mol |
| Exact Mass | 668.53 |
| IUPAC Name | 4-[5a,5b,8,8,11a-pentamethyl-3a-[(3-piperidin-1-ylpropylamino)methyl]-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
| SMILES | C=C(C)C1CCC2(CNCCCN3CCCCC3)CCC3(C)C(CCC4C5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C45H68N2O2/c1-31(2)34-18-23-45(30-46-26-11-29-47-27-9-8-10-28-47)25-24-43(6)36(39(34)45)16-17-38-42(5)21-19-35(32-12-14-33(15-13-32)40(48)49)41(3,4)37(42)20-22-44(38,43)7/h12-15,19,34,36-39,46H,1,8-11,16-18,20-30H2,2-7H3,(H,48,49) |
| InChIKey | VARYCWQBMXQGKD-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.05 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|