C43H66N2O2 — CID 72665207
4-[3a-[[2-(diethylamino)ethylamino]methyl]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid (PubChem CID 72665207) has the molecular formula C43H66N2O2 and a molecular weight of 643.01 g/mol. Its IUPAC name is 4-[3a-[[2-(diethylamino)ethylamino]methyl]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid.
| Compound Name | 4-[3a-[[2-(diethylamino)ethylamino]methyl]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 72665207 |
| Molecular Formula | C43H66N2O2 |
| Molecular Weight | 643.01 g/mol |
| Exact Mass | 642.51 |
| IUPAC Name | 4-[3a-[[2-(diethylamino)ethylamino]methyl]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
| SMILES | C=C(C)C1CCC2(CNCCN(CC)CC)CCC3(C)C(CCC4C5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C43H66N2O2/c1-10-45(11-2)27-26-44-28-43-23-18-32(29(3)4)37(43)34-16-17-36-40(7)21-19-33(30-12-14-31(15-13-30)38(46)47)39(5,6)35(40)20-22-42(36,9)41(34,8)24-25-43/h12-15,19,32,34-37,44H,3,10-11,16-18,20-28H2,1-2,4-9H3,(H,46,47) |
| InChIKey | OLQUNWGZDAWVKP-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.01 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|