C46H61NO4 — CID 78127003
4-[2-[[9-(4-carboxyphenyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-3a-yl]methylamino]ethyl]benzoic acid (PubChem CID 78127003) has the molecular formula C46H61NO4 and a molecular weight of 692.00 g/mol. Its IUPAC name is 4-[2-[[9-(4-carboxyphenyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-3a-yl]methylamino]ethyl]benzoic acid.
| Compound Name | 4-[2-[[9-(4-carboxyphenyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-3a-yl]methylamino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 78127003 |
| Molecular Formula | C46H61NO4 |
| Molecular Weight | 692.00 g/mol |
| Exact Mass | 691.46 |
| IUPAC Name | 4-[2-[[9-(4-carboxyphenyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-3a-yl]methylamino]ethyl]benzoic acid |
| SMILES | C=C(C)C1CCC2(CNCCc3ccc(C(=O)O)cc3)CCC3(C)C(CCC4C5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C46H61NO4/c1-29(2)34-18-24-46(28-47-27-21-30-8-10-32(11-9-30)40(48)49)26-25-44(6)36(39(34)46)16-17-38-43(5)22-19-35(31-12-14-33(15-13-31)41(50)51)42(3,4)37(43)20-23-45(38,44)7/h8-15,19,34,36-39,47H,1,16-18,20-28H2,2-7H3,(H,48,49)(H,50,51) |
| InChIKey | GMUZJJOMMLXKFG-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.00 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|