C43H64N2O2S — CID 78126598
4-[5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-3a-[(2-thiomorpholin-4-ylethylamino)methyl]-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid (PubChem CID 78126598) has the molecular formula C43H64N2O2S and a molecular weight of 673.06 g/mol. Its IUPAC name is 4-[5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-3a-[(2-thiomorpholin-4-ylethylamino)methyl]-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid.
| Compound Name | 4-[5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-3a-[(2-thiomorpholin-4-ylethylamino)methyl]-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 78126598 |
| Molecular Formula | C43H64N2O2S |
| Molecular Weight | 673.06 g/mol |
| Exact Mass | 672.47 |
| IUPAC Name | 4-[5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-3a-[(2-thiomorpholin-4-ylethylamino)methyl]-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
| SMILES | C=C(C)C1CCC2(CNCCN3CCSCC3)CCC3(C)C(CCC4C5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C43H64N2O2S/c1-29(2)32-14-19-43(28-44-22-23-45-24-26-48-27-25-45)21-20-41(6)34(37(32)43)12-13-36-40(5)17-15-33(30-8-10-31(11-9-30)38(46)47)39(3,4)35(40)16-18-42(36,41)7/h8-11,15,32,34-37,44H,1,12-14,16-28H2,2-7H3,(H,46,47) |
| InChIKey | XGTGONYUKTWRGG-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.06 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|