C28H46O — CID 162834323
1-(1,2,4,13,17,17-hexamethyl-7-pentacyclo[10.8.0.02,9.04,8.013,18]icosanyl)ethanone (PubChem CID 162834323) has the molecular formula C28H46O and a molecular weight of 398.68 g/mol. Its IUPAC name is 1-(1,2,4,13,17,17-hexamethyl-7-pentacyclo[10.8.0.02,9.04,8.013,18]icosanyl)ethanone.
| Compound Name | 1-(1,2,4,13,17,17-hexamethyl-7-pentacyclo[10.8.0.02,9.04,8.013,18]icosanyl)ethanone |
|---|---|
| PubChem CID | 162834323 |
| Molecular Formula | C28H46O |
| Molecular Weight | 398.68 g/mol |
| Exact Mass | 398.35 |
| IUPAC Name | 1-(1,2,4,13,17,17-hexamethyl-7-pentacyclo[10.8.0.02,9.04,8.013,18]icosanyl)ethanone |
| SMILES | CC(=O)C1CCC2(C)CC3(C)C(CCC4C5(C)CCCC(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C28H46O/c1-18(29)19-11-15-25(4)17-28(7)20(23(19)25)9-10-22-26(5)14-8-13-24(2,3)21(26)12-16-27(22,28)6/h19-23H,8-17H2,1-7H3 |
| InChIKey | RJUGDIOOWAFMDB-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.68 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |