C19H26O4 — CID 102376683
(1S,2R,3S,6R,9S,10R,11R,13R)-1,13-dihydroxy-9,13-dimethyl-2-prop-1-en-2-yltetracyclo[8.3.1.03,11.06,11]tetradecane-12,14-dione (PubChem CID 102376683) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is (1S,2R,3S,6R,9S,10R,11R,13R)-1,13-dihydroxy-9,13-dimethyl-2-prop-1-en-2-yltetracyclo[8.3.1.03,11.06,11]tetradecane-12,14-dione.
| Compound Name | (1S,2R,3S,6R,9S,10R,11R,13R)-1,13-dihydroxy-9,13-dimethyl-2-prop-1-en-2-yltetracyclo[8.3.1.03,11.06,11]tetradecane-12,14-dione |
|---|---|
| PubChem CID | 102376683 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (1S,2R,3S,6R,9S,10R,11R,13R)-1,13-dihydroxy-9,13-dimethyl-2-prop-1-en-2-yltetracyclo[8.3.1.03,11.06,11]tetradecane-12,14-dione |
| SMILES | C=C(C)[C@H]1[C@@H]2CC[C@H]3CC[C@H](C)[C@H]4C(=O)[C@@]1(O)[C@@](C)(O)C(=O)[C@@]342 |
| InChI | InChI=1S/C19H26O4/c1-9(2)13-12-8-7-11-6-5-10(3)14-15(20)19(13,23)17(4,22)16(21)18(11,12)14/h10-14,22-23H,1,5-8H2,2-4H3/t10-,11+,12-,13-,14-,17-,18+,19+/m0/s1 |
| InChIKey | JHQJRQXNRVJUFL-DIUVHZLSSA-N |
| XLogP | 1.88 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|