C22H40N2 — CID 163155375
methanidyl-[7-(methanidylazaniumyl)-1,4,7,8-tetramethyl-2,3,3a,4,5,5a,6,8,8a,9,10,10a,10b,10c-tetradecahydropyren-1-yl]azanium (PubChem CID 163155375) has the molecular formula C22H40N2 and a molecular weight of 332.58 g/mol. Its IUPAC name is methanidyl-[7-(methanidylazaniumyl)-1,4,7,8-tetramethyl-2,3,3a,4,5,5a,6,8,8a,9,10,10a,10b,10c-tetradecahydropyren-1-yl]azanium.
| Compound Name | methanidyl-[7-(methanidylazaniumyl)-1,4,7,8-tetramethyl-2,3,3a,4,5,5a,6,8,8a,9,10,10a,10b,10c-tetradecahydropyren-1-yl]azanium |
|---|---|
| PubChem CID | 163155375 |
| Molecular Formula | C22H40N2 |
| Molecular Weight | 332.58 g/mol |
| Exact Mass | 332.32 |
| IUPAC Name | methanidyl-[7-(methanidylazaniumyl)-1,4,7,8-tetramethyl-2,3,3a,4,5,5a,6,8,8a,9,10,10a,10b,10c-tetradecahydropyren-1-yl]azanium |
| SMILES | [CH2-][NH2+]C1(C)CC2CC(C)C3CCC(C)([NH2+][CH2-])C4CCC(C2C34)C1C |
| InChI | InChI=1S/C22H40N2/c1-13-11-15-12-22(4,24-6)14(2)17-7-8-18-20(19(15)17)16(13)9-10-21(18,3)23-5/h13-20H,5-12,23-24H2,1-4H3 |
| InChIKey | OXLVSXJXLPQQCS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 33.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.58 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|