C16H25I — CID 170200272
11-iodo-4-methyl-4-propan-2-yltetracyclo[6.2.1.13,6.02,7]dodecane (PubChem CID 170200272) has the molecular formula C16H25I and a molecular weight of 344.28 g/mol. Its IUPAC name is 11-iodo-4-methyl-4-propan-2-yltetracyclo[6.2.1.13,6.02,7]dodecane.
| Compound Name | 11-iodo-4-methyl-4-propan-2-yltetracyclo[6.2.1.13,6.02,7]dodecane |
|---|---|
| PubChem CID | 170200272 |
| Molecular Formula | C16H25I |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 11-iodo-4-methyl-4-propan-2-yltetracyclo[6.2.1.13,6.02,7]dodecane |
| SMILES | CC(C)C1(C)CC2CC1C1C3CCC(C3I)C21 |
| InChI | InChI=1S/C16H25I/c1-8(2)16(3)7-9-6-12(16)14-11-5-4-10(13(9)14)15(11)17/h8-15H,4-7H2,1-3H3 |
| InChIKey | XPCGKHPSRZMMRS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|