C13H22 — CID 91310355
4-methyl-2-propan-2-yltricyclo[6.1.0.03,5]nonane (PubChem CID 91310355) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is 4-methyl-2-propan-2-yltricyclo[6.1.0.03,5]nonane.
| Compound Name | 4-methyl-2-propan-2-yltricyclo[6.1.0.03,5]nonane |
|---|---|
| PubChem CID | 91310355 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 4-methyl-2-propan-2-yltricyclo[6.1.0.03,5]nonane |
| SMILES | CC(C)C1C2CC2CCC2C(C)C21 |
| InChI | InChI=1S/C13H22/c1-7(2)12-11-6-9(11)4-5-10-8(3)13(10)12/h7-13H,4-6H2,1-3H3 |
| InChIKey | SROZFXWBCRGCNQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |