About 1-cyclopropyl-2,4-dimethyl-3-propan-2-ylcyclopentane
1-cyclopropyl-2,4-dimethyl-3-propan-2-ylcyclopentane (PubChem CID 123954813) has the molecular formula C13H24
and a molecular weight of 180.33 g/mol. Its IUPAC name is 1-cyclopropyl-2,4-dimethyl-3-propan-2-ylcyclopentane.
Analyze 1-cyclopropyl-2,4-dimethyl-3-propan-2-ylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-2,4-dimethyl-3-propan-2-ylcyclopentane?
The IUPAC name of 1-cyclopropyl-2,4-dimethyl-3-propan-2-ylcyclopentane (CID 123954813) is 1-cyclopropyl-2,4-dimethyl-3-propan-2-ylcyclopentane.
What is the SMILES notation for 1-cyclopropyl-2,4-dimethyl-3-propan-2-ylcyclopentane?
The canonical SMILES for 1-cyclopropyl-2,4-dimethyl-3-propan-2-ylcyclopentane is CC(C)C1C(C)CC(C2CC2)C1C.
What is the InChIKey of 1-cyclopropyl-2,4-dimethyl-3-propan-2-ylcyclopentane?
The InChIKey is KELSOUDJJSDBQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24/c1-8(2)13-9(3)7-12(10(13)4)11-5-6-11/h8-13H,5-7H2,1-4H3.
What are the key properties of 1-cyclopropyl-2,4-dimethyl-3-propan-2-ylcyclopentane?
1-cyclopropyl-2,4-dimethyl-3-propan-2-ylcyclopentane has a molecular weight of 180.33 g/mol, XLogP of 3.96, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-2,4-dimethyl-3-propan-2-ylcyclopentane is sourced from PubChem (CID 123954813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).