C12H22 — CID 158984587
(2R,3R)-2-methyl-3-propan-2-ylbicyclo[2.2.2]octane (PubChem CID 158984587) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is (2R,3R)-2-methyl-3-propan-2-ylbicyclo[2.2.2]octane.
| Compound Name | (2R,3R)-2-methyl-3-propan-2-ylbicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 158984587 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | (2R,3R)-2-methyl-3-propan-2-ylbicyclo[2.2.2]octane |
| SMILES | CC(C)[C@@H]1C2CCC(CC2)[C@H]1C |
| InChI | InChI=1S/C12H22/c1-8(2)12-9(3)10-4-6-11(12)7-5-10/h8-12H,4-7H2,1-3H3/t9-,10?,11?,12+/m1/s1 |
| InChIKey | JPKMITGIRULTDD-YYJSSNLHSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |