C13H20O4 — CID 59102887
2-methyl-3-(3-methyl-2-bicyclo[2.2.1]heptanyl)butanedioic acid (PubChem CID 59102887) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is 2-methyl-3-(3-methyl-2-bicyclo[2.2.1]heptanyl)butanedioic acid.
| Compound Name | 2-methyl-3-(3-methyl-2-bicyclo[2.2.1]heptanyl)butanedioic acid |
|---|---|
| PubChem CID | 59102887 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2-methyl-3-(3-methyl-2-bicyclo[2.2.1]heptanyl)butanedioic acid |
| SMILES | CC(C(=O)O)C(C(=O)O)C1C2CCC(C2)C1C |
| InChI | InChI=1S/C13H20O4/c1-6-8-3-4-9(5-8)10(6)11(13(16)17)7(2)12(14)15/h6-11H,3-5H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | WKHPGCHTHYNHMX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |