About 3,5,8-trimethyl-7-propan-2-yltricyclo[4.2.0.02,4]octane
3,5,8-trimethyl-7-propan-2-yltricyclo[4.2.0.02,4]octane (PubChem CID 123828648) has the molecular formula C14H24
and a molecular weight of 192.35 g/mol. Its IUPAC name is 3,5,8-trimethyl-7-propan-2-yltricyclo[4.2.0.02,4]octane.
Analyze 3,5,8-trimethyl-7-propan-2-yltricyclo[4.2.0.02,4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5,8-trimethyl-7-propan-2-yltricyclo[4.2.0.02,4]octane?
The IUPAC name of 3,5,8-trimethyl-7-propan-2-yltricyclo[4.2.0.02,4]octane (CID 123828648) is 3,5,8-trimethyl-7-propan-2-yltricyclo[4.2.0.02,4]octane.
What is the SMILES notation for 3,5,8-trimethyl-7-propan-2-yltricyclo[4.2.0.02,4]octane?
The canonical SMILES for 3,5,8-trimethyl-7-propan-2-yltricyclo[4.2.0.02,4]octane is CC(C)C1C(C)C2C1C(C)C1C(C)C12.
What is the InChIKey of 3,5,8-trimethyl-7-propan-2-yltricyclo[4.2.0.02,4]octane?
The InChIKey is JOMPEFOHMDRQIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24/c1-6(2)10-7(3)14-12(10)8(4)11-9(5)13(11)14/h6-14H,1-5H3.
What are the key properties of 3,5,8-trimethyl-7-propan-2-yltricyclo[4.2.0.02,4]octane?
3,5,8-trimethyl-7-propan-2-yltricyclo[4.2.0.02,4]octane has a molecular weight of 192.35 g/mol, XLogP of 3.67, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5,8-trimethyl-7-propan-2-yltricyclo[4.2.0.02,4]octane is sourced from PubChem (CID 123828648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).