About 1-(4,5-dimethyl-2-bicyclo[1.1.1]pentanyl)ethanamine
1-(4,5-dimethyl-2-bicyclo[1.1.1]pentanyl)ethanamine (PubChem CID 163525148) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is 1-(4,5-dimethyl-2-bicyclo[1.1.1]pentanyl)ethanamine.
Analyze 1-(4,5-dimethyl-2-bicyclo[1.1.1]pentanyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dimethyl-2-bicyclo[1.1.1]pentanyl)ethanamine?
The IUPAC name of 1-(4,5-dimethyl-2-bicyclo[1.1.1]pentanyl)ethanamine (CID 163525148) is 1-(4,5-dimethyl-2-bicyclo[1.1.1]pentanyl)ethanamine.
What is the SMILES notation for 1-(4,5-dimethyl-2-bicyclo[1.1.1]pentanyl)ethanamine?
The canonical SMILES for 1-(4,5-dimethyl-2-bicyclo[1.1.1]pentanyl)ethanamine is CC(N)C1C2C(C)C1C2C.
What is the InChIKey of 1-(4,5-dimethyl-2-bicyclo[1.1.1]pentanyl)ethanamine?
The InChIKey is DOCOMCVQXZRCPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N/c1-4-7-5(2)8(4)9(7)6(3)10/h4-9H,10H2,1-3H3.
What are the key properties of 1-(4,5-dimethyl-2-bicyclo[1.1.1]pentanyl)ethanamine?
1-(4,5-dimethyl-2-bicyclo[1.1.1]pentanyl)ethanamine has a molecular weight of 139.24 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dimethyl-2-bicyclo[1.1.1]pentanyl)ethanamine is sourced from PubChem (CID 163525148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).