C17H30O2 — CID 71026773
(3,5-diethyl-8-methyl-8-tricyclo[5.2.1.02,6]decanyl)-methoxymethanol (PubChem CID 71026773) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is (3,5-diethyl-8-methyl-8-tricyclo[5.2.1.02,6]decanyl)-methoxymethanol.
| Compound Name | (3,5-diethyl-8-methyl-8-tricyclo[5.2.1.02,6]decanyl)-methoxymethanol |
|---|---|
| PubChem CID | 71026773 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (3,5-diethyl-8-methyl-8-tricyclo[5.2.1.02,6]decanyl)-methoxymethanol |
| SMILES | CCC1CC(CC)C2C1C1CC2C(C)(C(O)OC)C1 |
| InChI | InChI=1S/C17H30O2/c1-5-10-7-11(6-2)15-13-8-12(14(10)15)9-17(13,3)16(18)19-4/h10-16,18H,5-9H2,1-4H3 |
| InChIKey | JOGAFLDLODNUJG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|