C16H28O2 — CID 70999175
(5-ethyl-3-propyl-8-tricyclo[5.2.1.02,6]decanyl)methanediol (PubChem CID 70999175) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is (5-ethyl-3-propyl-8-tricyclo[5.2.1.02,6]decanyl)methanediol.
| Compound Name | (5-ethyl-3-propyl-8-tricyclo[5.2.1.02,6]decanyl)methanediol |
|---|---|
| PubChem CID | 70999175 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (5-ethyl-3-propyl-8-tricyclo[5.2.1.02,6]decanyl)methanediol |
| SMILES | CCCC1CC(CC)C2C3CC(CC3C(O)O)C12 |
| InChI | InChI=1S/C16H28O2/c1-3-5-10-6-9(4-2)15-12-7-11(14(10)15)8-13(12)16(17)18/h9-18H,3-8H2,1-2H3 |
| InChIKey | JEUPFBDZFGWTQS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|