C21H35F3O2 — CID 91444187
2-(2-methoxyethoxy)butane;4-methyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane (PubChem CID 91444187) has the molecular formula C21H35F3O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)butane;4-methyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane.
| Compound Name | 2-(2-methoxyethoxy)butane;4-methyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane |
|---|---|
| PubChem CID | 91444187 |
| Molecular Formula | C21H35F3O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | 2-(2-methoxyethoxy)butane;4-methyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane |
| SMILES | CC1(C(F)(F)F)CC2CC1C1C3CCC(C3)C21.CCC(C)OCCOC |
| InChI | InChI=1S/C14H19F3.C7H16O2/c1-13(14(15,16)17)6-9-5-10(13)12-8-3-2-7(4-8)11(9)12;1-4-7(2)9-6-5-8-3/h7-12H,2-6H2,1H3;7H,4-6H2,1-3H3 |
| InChIKey | BSMUFWLJVMOOPM-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|