C21H33F7O2Si — CID 91505287
dimethoxy(dimethyl)silane;4-fluoro-4-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane (PubChem CID 91505287) has the molecular formula C21H33F7O2Si and a molecular weight of 478.57 g/mol. Its IUPAC name is dimethoxy(dimethyl)silane;4-fluoro-4-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane.
| Compound Name | dimethoxy(dimethyl)silane;4-fluoro-4-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane |
|---|---|
| PubChem CID | 91505287 |
| Molecular Formula | C21H33F7O2Si |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | dimethoxy(dimethyl)silane;4-fluoro-4-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane |
| SMILES | CC(CC1(F)CC2CC1C1C3CCC(C3)C21)(C(F)(F)F)C(F)(F)F.CO[Si](C)(C)OC |
| InChI | InChI=1S/C17H21F7.C4H12O2Si/c1-14(16(19,20)21,17(22,23)24)7-15(18)6-10-5-11(15)13-9-3-2-8(4-9)12(10)13;1-5-7(3,4)6-2/h8-13H,2-7H2,1H3;1-4H3 |
| InChIKey | DAJUXUNSGIIKPV-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|