C19H30O3Si — CID 90710044
spiro[oxolane-3,4'-tetracyclo[6.2.1.13,6.02,7]dodecane]-2,5-dione;tetramethylsilane (PubChem CID 90710044) has the molecular formula C19H30O3Si and a molecular weight of 334.53 g/mol. Its IUPAC name is spiro[oxolane-3,4'-tetracyclo[6.2.1.13,6.02,7]dodecane]-2,5-dione;tetramethylsilane.
| Compound Name | spiro[oxolane-3,4'-tetracyclo[6.2.1.13,6.02,7]dodecane]-2,5-dione;tetramethylsilane |
|---|---|
| PubChem CID | 90710044 |
| Molecular Formula | C19H30O3Si |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | spiro[oxolane-3,4'-tetracyclo[6.2.1.13,6.02,7]dodecane]-2,5-dione;tetramethylsilane |
| SMILES | C[Si](C)(C)C.O=C1CC2(CC3CC2C2C4CCC(C4)C32)C(=O)O1 |
| InChI | InChI=1S/C15H18O3.C4H12Si/c16-11-6-15(14(17)18-11)5-9-4-10(15)13-8-2-1-7(3-8)12(9)13;1-5(2,3)4/h7-10,12-13H,1-6H2;1-4H3 |
| InChIKey | SPHDOFFEKOLTKN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|