C14H22O2 — CID 153180704
[4-(hydroxymethyl)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]methanol (PubChem CID 153180704) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is [4-(hydroxymethyl)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]methanol.
| Compound Name | [4-(hydroxymethyl)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]methanol |
|---|---|
| PubChem CID | 153180704 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | [4-(hydroxymethyl)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]methanol |
| SMILES | OCC1(CO)CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C14H22O2/c15-6-14(7-16)5-10-4-11(14)13-9-2-1-8(3-9)12(10)13/h8-13,15-16H,1-7H2 |
| InChIKey | WGCMGSWFNRJYQT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|