C12H16O3 — CID 21344443
5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,3'-oxolane]-2',5'-dione (PubChem CID 21344443) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,3'-oxolane]-2',5'-dione.
| Compound Name | 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,3'-oxolane]-2',5'-dione |
|---|---|
| PubChem CID | 21344443 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,3'-oxolane]-2',5'-dione |
| SMILES | CC1C2CC(C1C)C1(CC(=O)OC1=O)C2 |
| InChI | InChI=1S/C12H16O3/c1-6-7(2)9-3-8(6)4-12(9)5-10(13)15-11(12)14/h6-9H,3-5H2,1-2H3 |
| InChIKey | PXNKWURREIFULY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|