About 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,5'-dioxane]-3'-one
5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,5'-dioxane]-3'-one (PubChem CID 89006311) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,5'-dioxane]-3'-one.
Molecular Properties
| Compound Name | 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,5'-dioxane]-3'-one |
| PubChem CID | 89006311 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,5'-dioxane]-3'-one |
| SMILES | CC1C2CC(C1C)C1(COOC(=O)C1)C2 |
| InChI | InChI=1S/C12H18O3/c1-7-8(2)10-3-9(7)4-12(10)5-11(13)15-14-6-12/h7-10H,3-6H2,1-2H3 |
| InChIKey | QDUFKJFASCYHGU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,5'-dioxane]-3'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,5'-dioxane]-3'-one?
The IUPAC name of 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,5'-dioxane]-3'-one (CID 89006311) is 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,5'-dioxane]-3'-one.
What is the SMILES notation for 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,5'-dioxane]-3'-one?
The canonical SMILES for 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,5'-dioxane]-3'-one is CC1C2CC(C1C)C1(COOC(=O)C1)C2.
What is the InChIKey of 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,5'-dioxane]-3'-one?
The InChIKey is QDUFKJFASCYHGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3/c1-7-8(2)10-3-9(7)4-12(10)5-11(13)15-14-6-12/h7-10H,3-6H2,1-2H3.
What are the key properties of 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,5'-dioxane]-3'-one?
5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,5'-dioxane]-3'-one has a molecular weight of 210.27 g/mol, XLogP of 2.16, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,5'-dioxane]-3'-one is sourced from PubChem (CID 89006311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).