C11H16O2S — CID 163654734
(5S)-5-methyl-5-sulfanylspiro[bicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one (PubChem CID 163654734) has the molecular formula C11H16O2S and a molecular weight of 212.31 g/mol. Its IUPAC name is (5S)-5-methyl-5-sulfanylspiro[bicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one.
| Compound Name | (5S)-5-methyl-5-sulfanylspiro[bicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one |
|---|---|
| PubChem CID | 163654734 |
| Molecular Formula | C11H16O2S |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | (5S)-5-methyl-5-sulfanylspiro[bicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one |
| SMILES | C[C@]1(S)CC2CC1CC21COC(=O)C1 |
| InChI | InChI=1S/C11H16O2S/c1-10(14)3-8-2-7(10)4-11(8)5-9(12)13-6-11/h7-8,14H,2-6H2,1H3/t7?,8?,10-,11?/m0/s1 |
| InChIKey | IPFGMGUNEPZSBW-JRASRSEESA-N |
| XLogP | 2.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|