About CID 163530000
CID 163530000 (PubChem CID 163530000) has the molecular formula C10H13INO2-
and a molecular weight of 306.12 g/mol.
Molecular Properties
| Compound Name | CID 163530000 |
| PubChem CID | 163530000 |
| Molecular Formula | C10H13INO2- |
| Molecular Weight | 306.12 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | — |
| SMILES | O=C1CC2(CO1)CC1CC2CC12N[I-]2 |
| InChI | InChI=1S/C10H13INO2/c13-8-4-9(5-14-8)2-7-1-6(9)3-10(7)11-12-10/h6-7,12H,1-5H2/q-1 |
| InChIKey | IGTYATOHXNLXHX-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.12 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 163530000 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163530000?
The IUPAC name of CID 163530000 (CID 163530000) is not available.
What is the SMILES notation for CID 163530000?
The canonical SMILES for CID 163530000 is O=C1CC2(CO1)CC1CC2CC12N[I-]2.
What is the InChIKey of CID 163530000?
The InChIKey is IGTYATOHXNLXHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13INO2/c13-8-4-9(5-14-8)2-7-1-6(9)3-10(7)11-12-10/h6-7,12H,1-5H2/q-1.
What are the key properties of CID 163530000?
CID 163530000 has a molecular weight of 306.12 g/mol, XLogP of -2.35, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163530000 is sourced from PubChem (CID 163530000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).