C10H13IO2 — CID 146617215
5-iodospiro[bicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one (PubChem CID 146617215) has the molecular formula C10H13IO2 and a molecular weight of 292.12 g/mol. Its IUPAC name is 5-iodospiro[bicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one.
| Compound Name | 5-iodospiro[bicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one |
|---|---|
| PubChem CID | 146617215 |
| Molecular Formula | C10H13IO2 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 5-iodospiro[bicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one |
| SMILES | O=C1CC2(CO1)CC1CC2CC1I |
| InChI | InChI=1S/C10H13IO2/c11-8-2-7-1-6(8)3-10(7)4-9(12)13-5-10/h6-8H,1-5H2 |
| InChIKey | IVPADNPZBWIKEI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|