C9H13IO2 — CID 166052318
(1'S,4'S)-5'-iodospiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane] (PubChem CID 166052318) has the molecular formula C9H13IO2 and a molecular weight of 280.11 g/mol. Its IUPAC name is (1'S,4'S)-5'-iodospiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane].
| Compound Name | (1'S,4'S)-5'-iodospiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane] |
|---|---|
| PubChem CID | 166052318 |
| Molecular Formula | C9H13IO2 |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | (1'S,4'S)-5'-iodospiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane] |
| SMILES | IC1C[C@@H]2C[C@H]1CC21OCCO1 |
| InChI | InChI=1S/C9H13IO2/c10-8-4-7-3-6(8)5-9(7)11-1-2-12-9/h6-8H,1-5H2/t6-,7-,8?/m0/s1 |
| InChIKey | GKXRYMPJVUTFAW-WPZUCAASSA-N |
| XLogP | 1.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|