C11H15IO2 — CID 117070185
3'-iodo-2'-methylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.2]oct-2-ene] (PubChem CID 117070185) has the molecular formula C11H15IO2 and a molecular weight of 306.14 g/mol. Its IUPAC name is 3'-iodo-2'-methylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.2]oct-2-ene].
| Compound Name | 3'-iodo-2'-methylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.2]oct-2-ene] |
|---|---|
| PubChem CID | 117070185 |
| Molecular Formula | C11H15IO2 |
| Molecular Weight | 306.14 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 3'-iodo-2'-methylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.2]oct-2-ene] |
| SMILES | CC1=C(I)C2CCC1CC21OCCO1 |
| InChI | InChI=1S/C11H15IO2/c1-7-8-2-3-9(10(7)12)11(6-8)13-4-5-14-11/h8-9H,2-6H2,1H3 |
| InChIKey | FRHZHILTDKESML-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.14 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|