C12H17NO3 — CID 90801410
6'-nitrosospiro[1,3-dioxolane-2,2'-adamantane] (PubChem CID 90801410) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 6'-nitrosospiro[1,3-dioxolane-2,2'-adamantane].
| Compound Name | 6'-nitrosospiro[1,3-dioxolane-2,2'-adamantane] |
|---|---|
| PubChem CID | 90801410 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 6'-nitrosospiro[1,3-dioxolane-2,2'-adamantane] |
| SMILES | O=NC1C2CC3CC1CC(C2)C31OCCO1 |
| InChI | InChI=1S/C12H17NO3/c14-13-11-7-3-9-5-8(11)6-10(4-7)12(9)15-1-2-16-12/h7-11H,1-6H2 |
| InChIKey | HGIIEUDRBAHGMO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |