C10H12O3 — CID 98164014
(1'S,3'S,5'S,7'S)-spiro[1,3-dioxolane-2,6'-tricyclo[5.1.0.03,5]octane]-2'-one (PubChem CID 98164014) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is (1'S,3'S,5'S,7'S)-spiro[1,3-dioxolane-2,6'-tricyclo[5.1.0.03,5]octane]-2'-one.
| Compound Name | (1'S,3'S,5'S,7'S)-spiro[1,3-dioxolane-2,6'-tricyclo[5.1.0.03,5]octane]-2'-one |
|---|---|
| PubChem CID | 98164014 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (1'S,3'S,5'S,7'S)-spiro[1,3-dioxolane-2,6'-tricyclo[5.1.0.03,5]octane]-2'-one |
| SMILES | O=C1[C@H]2C[C@@H]2C2(OCCO2)[C@H]2C[C@H]12 |
| InChI | InChI=1S/C10H12O3/c11-9-5-3-7(5)10(8-4-6(8)9)12-1-2-13-10/h5-8H,1-4H2/t5-,6-,7-,8-/m0/s1 |
| InChIKey | BXEPXNJZQDKLGV-XAMCCFCMSA-N |
| XLogP | 0.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |