C14H19BrO4 — CID 162412842
(3'aR,8'bR)-2'-bromo-5'-hydroxyspiro[1,3-dioxolane-2,1'-2,3,3a,4a,5,6,7,8,8a,8b-decahydrocyclopenta[a]indene]-4'-one (PubChem CID 162412842) has the molecular formula C14H19BrO4 and a molecular weight of 331.21 g/mol. Its IUPAC name is (3'aR,8'bR)-2'-bromo-5'-hydroxyspiro[1,3-dioxolane-2,1'-2,3,3a,4a,5,6,7,8,8a,8b-decahydrocyclopenta[a]indene]-4'-one.
| Compound Name | (3'aR,8'bR)-2'-bromo-5'-hydroxyspiro[1,3-dioxolane-2,1'-2,3,3a,4a,5,6,7,8,8a,8b-decahydrocyclopenta[a]indene]-4'-one |
|---|---|
| PubChem CID | 162412842 |
| Molecular Formula | C14H19BrO4 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | (3'aR,8'bR)-2'-bromo-5'-hydroxyspiro[1,3-dioxolane-2,1'-2,3,3a,4a,5,6,7,8,8a,8b-decahydrocyclopenta[a]indene]-4'-one |
| SMILES | O=C1C2C(O)CCCC2[C@@H]2[C@H]1CC(Br)C21OCCO1 |
| InChI | InChI=1S/C14H19BrO4/c15-10-6-8-12(14(10)18-4-5-19-14)7-2-1-3-9(16)11(7)13(8)17/h7-12,16H,1-6H2/t7?,8-,9?,10?,11?,12-/m1/s1 |
| InChIKey | PUTIJJUWCKOKKB-XMGFGMSJSA-N |
| XLogP | 1.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|