C11H16N2O2 — CID 123541321
4,5-dinitrosotricyclo[4.3.1.13,8]undecane (PubChem CID 123541321) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 4,5-dinitrosotricyclo[4.3.1.13,8]undecane.
| Compound Name | 4,5-dinitrosotricyclo[4.3.1.13,8]undecane |
|---|---|
| PubChem CID | 123541321 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 4,5-dinitrosotricyclo[4.3.1.13,8]undecane |
| SMILES | O=NC1C2CC3CC(C2)CC(C3)C1N=O |
| InChI | InChI=1S/C11H16N2O2/c14-12-10-8-2-6-1-7(4-8)5-9(3-6)11(10)13-15/h6-11H,1-5H2 |
| InChIKey | ZXAXDGOSXAYOKV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |