C12H17FO2 — CID 91619929
1'-fluorospiro[1,3-dioxolane-2,4'-adamantane] (PubChem CID 91619929) has the molecular formula C12H17FO2 and a molecular weight of 212.26 g/mol. Its IUPAC name is 1'-fluorospiro[1,3-dioxolane-2,4'-adamantane].
| Compound Name | 1'-fluorospiro[1,3-dioxolane-2,4'-adamantane] |
|---|---|
| PubChem CID | 91619929 |
| Molecular Formula | C12H17FO2 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1'-fluorospiro[1,3-dioxolane-2,4'-adamantane] |
| SMILES | FC12CC3CC(C1)C1(OCCO1)C(C3)C2 |
| InChI | InChI=1S/C12H17FO2/c13-11-5-8-3-9(6-11)12(10(4-8)7-11)14-1-2-15-12/h8-10H,1-7H2 |
| InChIKey | IYOIPYOBDDTBKY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |