C12H17FO — CID 10821727
(1'S,8'R)-3'-fluorospiro[oxirane-2,9'-tricyclo[4.3.1.13,8]undecane] (PubChem CID 10821727) has the molecular formula C12H17FO and a molecular weight of 196.26 g/mol. Its IUPAC name is (1'S,8'R)-3'-fluorospiro[oxirane-2,9'-tricyclo[4.3.1.13,8]undecane].
| Compound Name | (1'S,8'R)-3'-fluorospiro[oxirane-2,9'-tricyclo[4.3.1.13,8]undecane] |
|---|---|
| PubChem CID | 10821727 |
| Molecular Formula | C12H17FO |
| Molecular Weight | 196.26 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | (1'S,8'R)-3'-fluorospiro[oxirane-2,9'-tricyclo[4.3.1.13,8]undecane] |
| SMILES | FC12CCC3C[C@H](C1)C1(CO1)[C@@H](C3)C2 |
| InChI | InChI=1S/C12H17FO/c13-11-2-1-8-3-9(5-11)12(7-14-12)10(4-8)6-11/h8-10H,1-7H2/t8?,9-,10+,11?,12? |
| InChIKey | VUUTWLWWVBCTHY-KTMJHZKESA-N |
| XLogP | 2.69 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|