About CID 163803280
CID 163803280 (PubChem CID 163803280) has the molecular formula C9H14IO2-
and a molecular weight of 281.11 g/mol.
Molecular Properties
| Compound Name | CID 163803280 |
| PubChem CID | 163803280 |
| Molecular Formula | C9H14IO2- |
| Molecular Weight | 281.11 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | — |
| SMILES | C1CC2CC1CC21CO[I-]OC1 |
| InChI | InChI=1S/C9H14IO2/c1-2-8-3-7(1)4-9(8)5-11-10-12-6-9/h7-8H,1-6H2/q-1 |
| InChIKey | OBLXYSAUDZUUPT-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.11 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 163803280 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163803280?
The IUPAC name of CID 163803280 (CID 163803280) is not available.
What is the SMILES notation for CID 163803280?
The canonical SMILES for CID 163803280 is C1CC2CC1CC21CO[I-]OC1.
What is the InChIKey of CID 163803280?
The InChIKey is OBLXYSAUDZUUPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14IO2/c1-2-8-3-7(1)4-9(8)5-11-10-12-6-9/h7-8H,1-6H2/q-1.
What are the key properties of CID 163803280?
CID 163803280 has a molecular weight of 281.11 g/mol, XLogP of -1.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163803280 is sourced from PubChem (CID 163803280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).