C7H10 — CID 91477743
tricyclo[3.1.1.01,3]heptane (PubChem CID 91477743) has the molecular formula C7H10 and a molecular weight of 94.16 g/mol. Its IUPAC name is tricyclo[3.1.1.01,3]heptane.
| Compound Name | tricyclo[3.1.1.01,3]heptane |
|---|---|
| PubChem CID | 91477743 |
| Molecular Formula | C7H10 |
| Molecular Weight | 94.16 g/mol |
| Exact Mass | 94.08 |
| IUPAC Name | tricyclo[3.1.1.01,3]heptane |
| SMILES | C1C2CC3(C2)CC13 |
| InChI | InChI=1S/C7H10/c1-5-2-7(3-5)4-6(1)7/h5-6H,1-4H2 |
| InChIKey | SDZGDZAAZKIUJB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 94.16 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |