About (3R)-7-methyltricyclo[3.3.1.01,3]nonane-7-carbonyl chloride
(3R)-7-methyltricyclo[3.3.1.01,3]nonane-7-carbonyl chloride (PubChem CID 163445637) has the molecular formula C11H15ClO
and a molecular weight of 198.69 g/mol. Its IUPAC name is (3R)-7-methyltricyclo[3.3.1.01,3]nonane-7-carbonyl chloride.
Molecular Properties
| Compound Name | (3R)-7-methyltricyclo[3.3.1.01,3]nonane-7-carbonyl chloride |
| PubChem CID | 163445637 |
| Molecular Formula | C11H15ClO |
| Molecular Weight | 198.69 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | (3R)-7-methyltricyclo[3.3.1.01,3]nonane-7-carbonyl chloride |
| SMILES | CC1(C(=O)Cl)CC2C[C@@H]3CC3(C2)C1 |
| InChI | InChI=1S/C11H15ClO/c1-10(9(12)13)3-7-2-8-5-11(8,4-7)6-10/h7-8H,2-6H2,1H3/t7?,8-,10?,11?/m1/s1 |
| InChIKey | BCGUKHGXIQRFAM-SSHYPLHYSA-N |
| XLogP | 2.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.69 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze (3R)-7-methyltricyclo[3.3.1.01,3]nonane-7-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-7-methyltricyclo[3.3.1.01,3]nonane-7-carbonyl chloride?
The IUPAC name of (3R)-7-methyltricyclo[3.3.1.01,3]nonane-7-carbonyl chloride (CID 163445637) is (3R)-7-methyltricyclo[3.3.1.01,3]nonane-7-carbonyl chloride.
What is the SMILES notation for (3R)-7-methyltricyclo[3.3.1.01,3]nonane-7-carbonyl chloride?
The canonical SMILES for (3R)-7-methyltricyclo[3.3.1.01,3]nonane-7-carbonyl chloride is CC1(C(=O)Cl)CC2C[C@@H]3CC3(C2)C1.
What is the InChIKey of (3R)-7-methyltricyclo[3.3.1.01,3]nonane-7-carbonyl chloride?
The InChIKey is BCGUKHGXIQRFAM-SSHYPLHYSA-N. The full InChI is InChI=1S/C11H15ClO/c1-10(9(12)13)3-7-2-8-5-11(8,4-7)6-10/h7-8H,2-6H2,1H3/t7?,8-,10?,11?/m1/s1.
What are the key properties of (3R)-7-methyltricyclo[3.3.1.01,3]nonane-7-carbonyl chloride?
(3R)-7-methyltricyclo[3.3.1.01,3]nonane-7-carbonyl chloride has a molecular weight of 198.69 g/mol, XLogP of 2.97, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-7-methyltricyclo[3.3.1.01,3]nonane-7-carbonyl chloride is sourced from PubChem (CID 163445637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).