C13H19ClO2 — CID 129418689
(2R)-2-chloro-2-[(5S,7R)-3-methyl-1-adamantyl]acetic acid (PubChem CID 129418689) has the molecular formula C13H19ClO2 and a molecular weight of 242.75 g/mol. Its IUPAC name is (2R)-2-chloro-2-[(5S,7R)-3-methyl-1-adamantyl]acetic acid.
| Compound Name | (2R)-2-chloro-2-[(5S,7R)-3-methyl-1-adamantyl]acetic acid |
|---|---|
| PubChem CID | 129418689 |
| Molecular Formula | C13H19ClO2 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (2R)-2-chloro-2-[(5S,7R)-3-methyl-1-adamantyl]acetic acid |
| SMILES | CC12C[C@H]3C[C@@H](C1)CC([C@@H](Cl)C(=O)O)(C3)C2 |
| InChI | InChI=1S/C13H19ClO2/c1-12-3-8-2-9(4-12)6-13(5-8,7-12)10(14)11(15)16/h8-10H,2-7H2,1H3,(H,15,16)/t8-,9+,10-,12?,13?/m0/s1 |
| InChIKey | YCYQNZBVYNGARM-KTHBZUIVSA-N |
| XLogP | 3.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|