C13H22 — CID 86249645
spiro[bicyclo[2.2.1]heptane-2,1'-cycloheptane] (PubChem CID 86249645) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is spiro[bicyclo[2.2.1]heptane-2,1'-cycloheptane].
| Compound Name | spiro[bicyclo[2.2.1]heptane-2,1'-cycloheptane] |
|---|---|
| PubChem CID | 86249645 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | spiro[bicyclo[2.2.1]heptane-2,1'-cycloheptane] |
| SMILES | C1CCCC2(CC1)CC1CCC2C1 |
| InChI | InChI=1S/C13H22/c1-2-4-8-13(7-3-1)10-11-5-6-12(13)9-11/h11-12H,1-10H2 |
| InChIKey | OKBWOQRSWALJBE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |