C18H32 — CID 157147118
bicyclo[2.2.1]heptane;spiro[5.5]undecane (PubChem CID 157147118) has the molecular formula C18H32 and a molecular weight of 248.45 g/mol. Its IUPAC name is bicyclo[2.2.1]heptane;spiro[5.5]undecane.
| Compound Name | bicyclo[2.2.1]heptane;spiro[5.5]undecane |
|---|---|
| PubChem CID | 157147118 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | bicyclo[2.2.1]heptane;spiro[5.5]undecane |
| SMILES | C1CC2CCC1C2.C1CCC2(CC1)CCCCC2 |
| InChI | InChI=1S/C11H20.C7H12/c1-3-7-11(8-4-1)9-5-2-6-10-11;1-2-7-4-3-6(1)5-7/h1-10H2;6-7H,1-5H2 |
| InChIKey | AKVICSANRYINFX-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |