C18H33N — CID 155119532
tricyclo[6.6.4.01,3]octadecan-5-amine (PubChem CID 155119532) has the molecular formula C18H33N and a molecular weight of 263.47 g/mol. Its IUPAC name is tricyclo[6.6.4.01,3]octadecan-5-amine.
| Compound Name | tricyclo[6.6.4.01,3]octadecan-5-amine |
|---|---|
| PubChem CID | 155119532 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | tricyclo[6.6.4.01,3]octadecan-5-amine |
| SMILES | NC1CCC2CCCCCCC3(CCCC2)CC3C1 |
| InChI | InChI=1S/C18H33N/c19-17-10-9-15-7-3-1-2-5-11-18(12-6-4-8-15)14-16(18)13-17/h15-17H,1-14,19H2 |
| InChIKey | DPPZJJJJBLSMJK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |