C20H38 — CID 158063107
bicyclo[4.4.2]dodecane;cyclooctane (PubChem CID 158063107) has the molecular formula C20H38 and a molecular weight of 278.52 g/mol. Its IUPAC name is bicyclo[4.4.2]dodecane;cyclooctane.
| Compound Name | bicyclo[4.4.2]dodecane;cyclooctane |
|---|---|
| PubChem CID | 158063107 |
| Molecular Formula | C20H38 |
| Molecular Weight | 278.52 g/mol |
| Exact Mass | 278.30 |
| IUPAC Name | bicyclo[4.4.2]dodecane;cyclooctane |
| SMILES | C1CCC2CCCCC(C1)CC2.C1CCCCCCC1 |
| InChI | InChI=1S/C12H22.C8H16/c1-2-6-12-8-4-3-7-11(5-1)9-10-12;1-2-4-6-8-7-5-3-1/h11-12H,1-10H2;1-8H2 |
| InChIKey | FKWVWNJALOLHGB-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.52 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |