About 1-azabicyclo[6.2.2]dodecane;methane
1-azabicyclo[6.2.2]dodecane;methane (PubChem CID 157160878) has the molecular formula C13H29N
and a molecular weight of 199.38 g/mol. Its IUPAC name is 1-azabicyclo[6.2.2]dodecane;methane.
Molecular Properties
| Compound Name | 1-azabicyclo[6.2.2]dodecane;methane |
| PubChem CID | 157160878 |
| Molecular Formula | C13H29N |
| Molecular Weight | 199.38 g/mol |
| Exact Mass | 199.23 |
| IUPAC Name | 1-azabicyclo[6.2.2]dodecane;methane |
| SMILES | C.C.C1CCCN2CCC(CC1)CC2 |
| InChI | InChI=1S/C11H21N.2CH4/c1-2-4-8-12-9-6-11(5-3-1)7-10-12;;/h11H,1-10H2;2*1H4 |
| InChIKey | AMIZCPMKQRDIJG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-azabicyclo[6.2.2]dodecane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[6.2.2]dodecane;methane?
The IUPAC name of 1-azabicyclo[6.2.2]dodecane;methane (CID 157160878) is 1-azabicyclo[6.2.2]dodecane;methane.
What is the SMILES notation for 1-azabicyclo[6.2.2]dodecane;methane?
The canonical SMILES for 1-azabicyclo[6.2.2]dodecane;methane is C.C.C1CCCN2CCC(CC1)CC2.
What is the InChIKey of 1-azabicyclo[6.2.2]dodecane;methane?
The InChIKey is AMIZCPMKQRDIJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N.2CH4/c1-2-4-8-12-9-6-11(5-3-1)7-10-12;;/h11H,1-10H2;2*1H4.
What are the key properties of 1-azabicyclo[6.2.2]dodecane;methane?
1-azabicyclo[6.2.2]dodecane;methane has a molecular weight of 199.38 g/mol, XLogP of 3.93, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[6.2.2]dodecane;methane is sourced from PubChem (CID 157160878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).