C37H106N2 — CID 162186921
cyclooctane;1,7-diazabicyclo[5.5.3]pentadecane;methane (PubChem CID 162186921) has the molecular formula C37H106N2 and a molecular weight of 579.27 g/mol. Its IUPAC name is cyclooctane;1,7-diazabicyclo[5.5.3]pentadecane;methane.
| Compound Name | cyclooctane;1,7-diazabicyclo[5.5.3]pentadecane;methane |
|---|---|
| PubChem CID | 162186921 |
| Molecular Formula | C37H106N2 |
| Molecular Weight | 579.27 g/mol |
| Exact Mass | 578.84 |
| IUPAC Name | cyclooctane;1,7-diazabicyclo[5.5.3]pentadecane;methane |
| SMILES | C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C1CCCCCCC1.C1CCN2CCCCCN(CC1)CCC2 |
| InChI | InChI=1S/C13H26N2.C8H16.16CH4/c1-3-8-14-10-5-2-6-11-15(9-4-1)13-7-12-14;1-2-4-6-8-7-5-3-1;;;;;;;;;;;;;;;;/h1-13H2;1-8H2;16*1H4 |
| InChIKey | ZPTUSRGVOWCRRJ-UHFFFAOYSA-N |
| XLogP | 15.65 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.27 |
| LogP ≤ 5 | 15.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |