C19H30N2 — CID 15448490
1,10-diazabicyclo[8.8.3]henicosa-5,14-diyne (PubChem CID 15448490) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 1,10-diazabicyclo[8.8.3]henicosa-5,14-diyne.
| Compound Name | 1,10-diazabicyclo[8.8.3]henicosa-5,14-diyne |
|---|---|
| PubChem CID | 15448490 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 1,10-diazabicyclo[8.8.3]henicosa-5,14-diyne |
| SMILES | C1#CCCCN2CCCC#CCCCN(CCC1)CCC2 |
| InChI | InChI=1S/C19H30N2/c1-2-6-10-15-21-17-12-8-4-3-7-11-16-20(14-9-5-1)18-13-19-21/h5-19H2 |
| InChIKey | JVYNXUCLCCIDJE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|