C12H24Cl2MnN4 — CID 158152491
4,11-dichloro-1,4,8,11-tetrazabicyclo[6.6.2]hexadecane;manganese (PubChem CID 158152491) has the molecular formula C12H24Cl2MnN4 and a molecular weight of 350.20 g/mol. Its IUPAC name is 4,11-dichloro-1,4,8,11-tetrazabicyclo[6.6.2]hexadecane;manganese.
| Compound Name | 4,11-dichloro-1,4,8,11-tetrazabicyclo[6.6.2]hexadecane;manganese |
|---|---|
| PubChem CID | 158152491 |
| Molecular Formula | C12H24Cl2MnN4 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 4,11-dichloro-1,4,8,11-tetrazabicyclo[6.6.2]hexadecane;manganese |
| SMILES | ClN1CCCN2CCN(Cl)CCCN(CC1)CC2.[Mn] |
| InChI | InChI=1S/C12H24Cl2N4.Mn/c13-17-5-1-3-15-7-8-16(10-11-17)4-2-6-18(14)12-9-15;/h1-12H2; |
| InChIKey | FVHADXJEYLCZCF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|