C18H24N2 — CID 15267349
1,8-diazabicyclo[6.6.6]icosa-4,11,17-triyne (PubChem CID 15267349) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 1,8-diazabicyclo[6.6.6]icosa-4,11,17-triyne.
| Compound Name | 1,8-diazabicyclo[6.6.6]icosa-4,11,17-triyne |
|---|---|
| PubChem CID | 15267349 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 1,8-diazabicyclo[6.6.6]icosa-4,11,17-triyne |
| SMILES | C1#CCCN2CCC#CCCN(CC1)CCC#CCC2 |
| InChI | InChI=1S/C18H24N2/c1-2-8-14-20-17-11-5-3-9-15-19(13-7-1)16-10-4-6-12-18-20/h7-18H2 |
| InChIKey | VMISOHZHXWEXAP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|