About (4Z)-1,8-diazabicyclo[6.6.6]icos-4-ene
(4Z)-1,8-diazabicyclo[6.6.6]icos-4-ene (PubChem CID 11300425) has the molecular formula C18H34N2
and a molecular weight of 278.48 g/mol. Its IUPAC name is (4Z)-1,8-diazabicyclo[6.6.6]icos-4-ene.
Molecular Properties
| Compound Name | (4Z)-1,8-diazabicyclo[6.6.6]icos-4-ene |
| PubChem CID | 11300425 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | (4Z)-1,8-diazabicyclo[6.6.6]icos-4-ene |
| SMILES | C1=C\CCN2CCCCCCN(CC/1)CCCCCC2 |
| InChI | InChI=1S/C18H34N2/c1-2-8-14-20-17-11-5-3-9-15-19(13-7-1)16-10-4-6-12-18-20/h1-2H,3-18H2/b2-1- |
| InChIKey | JGNDYAKMSFXKKL-UPHRSURJSA-N |
| XLogP | 4.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-1,8-diazabicyclo[6.6.6]icos-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-1,8-diazabicyclo[6.6.6]icos-4-ene?
The IUPAC name of (4Z)-1,8-diazabicyclo[6.6.6]icos-4-ene (CID 11300425) is (4Z)-1,8-diazabicyclo[6.6.6]icos-4-ene.
What is the SMILES notation for (4Z)-1,8-diazabicyclo[6.6.6]icos-4-ene?
The canonical SMILES for (4Z)-1,8-diazabicyclo[6.6.6]icos-4-ene is C1=C\CCN2CCCCCCN(CC/1)CCCCCC2.
What is the InChIKey of (4Z)-1,8-diazabicyclo[6.6.6]icos-4-ene?
The InChIKey is JGNDYAKMSFXKKL-UPHRSURJSA-N. The full InChI is InChI=1S/C18H34N2/c1-2-8-14-20-17-11-5-3-9-15-19(13-7-1)16-10-4-6-12-18-20/h1-2H,3-18H2/b2-1-.
What are the key properties of (4Z)-1,8-diazabicyclo[6.6.6]icos-4-ene?
(4Z)-1,8-diazabicyclo[6.6.6]icos-4-ene has a molecular weight of 278.48 g/mol, XLogP of 4.07, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-1,8-diazabicyclo[6.6.6]icos-4-ene is sourced from PubChem (CID 11300425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).