sodium 1-azabicyclo[2.2.2]octane

C7H13NNa+ — CID 172740367

IUPACsodium 1-azabicyclo[2.2.2]octane
SMILESC1CN2CCC1CC2.[Na+]
InChIInChI=1S/C7H13N.Na/c1-4-8-5-2-7(1)3-6-8;/h7H,1-6H2;/q;+1
InChIKeyJABOKOIWMZEMGG-UHFFFAOYSA-N
MW134.18 g/mol
LogP-1.89
Rot. Bonds

About sodium 1-azabicyclo[2.2.2]octane

sodium 1-azabicyclo[2.2.2]octane (PubChem CID 172740367) has the molecular formula C7H13NNa+ and a molecular weight of 134.18 g/mol. Its IUPAC name is sodium 1-azabicyclo[2.2.2]octane.

Molecular Properties

Compound Namesodium 1-azabicyclo[2.2.2]octane
PubChem CID172740367
Molecular FormulaC7H13NNa+
Molecular Weight134.18 g/mol
Exact Mass134.09
IUPAC Namesodium 1-azabicyclo[2.2.2]octane
SMILESC1CN2CCC1CC2.[Na+]
InChIInChI=1S/C7H13N.Na/c1-4-8-5-2-7(1)3-6-8;/h7H,1-6H2;/q;+1
InChIKeyJABOKOIWMZEMGG-UHFFFAOYSA-N
XLogP-1.89
TPSA3.24 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500134.18
LogP ≤ 5-1.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze sodium 1-azabicyclo[2.2.2]octane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 1-azabicyclo[2.2.2]octane?
The IUPAC name of sodium 1-azabicyclo[2.2.2]octane (CID 172740367) is sodium 1-azabicyclo[2.2.2]octane.
What is the SMILES notation for sodium 1-azabicyclo[2.2.2]octane?
The canonical SMILES for sodium 1-azabicyclo[2.2.2]octane is C1CN2CCC1CC2.[Na+].
What is the InChIKey of sodium 1-azabicyclo[2.2.2]octane?
The InChIKey is JABOKOIWMZEMGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N.Na/c1-4-8-5-2-7(1)3-6-8;/h7H,1-6H2;/q;+1.
What are the key properties of sodium 1-azabicyclo[2.2.2]octane?
sodium 1-azabicyclo[2.2.2]octane has a molecular weight of 134.18 g/mol, XLogP of -1.89, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1-azabicyclo[2.2.2]octane is sourced from PubChem (CID 172740367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).